C21H24N6O4S — CID 3192836
N-cyclopentyl-2-[5-[2-[(4-methoxyphenyl)sulfonylamino]phenyl]tetrazol-2-yl]acetamide (PubChem CID 3192836) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is N-cyclopentyl-2-[5-[2-[(4-methoxyphenyl)sulfonylamino]phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[5-[2-[(4-methoxyphenyl)sulfonylamino]phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3192836 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-cyclopentyl-2-[5-[2-[(4-methoxyphenyl)sulfonylamino]phenyl]tetrazol-2-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2-c2nnn(CC(=O)NC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C21H24N6O4S/c1-31-16-10-12-17(13-11-16)32(29,30)25-19-9-5-4-8-18(19)21-23-26-27(24-21)14-20(28)22-15-6-2-3-7-15/h4-5,8-13,15,25H,2-3,6-7,14H2,1H3,(H,22,28) |
| InChIKey | YFOWNZVARBXKOZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |