C23H26N6O2 — CID 3744341
N-[2-[2-[2-(cyclopentylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-phenylpropanamide (PubChem CID 3744341) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[2-[2-[2-(cyclopentylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-phenylpropanamide.
| Compound Name | N-[2-[2-[2-(cyclopentylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 3744341 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-[2-[2-[2-(cyclopentylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccccc1-c1nnn(CC(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C23H26N6O2/c30-21(15-14-17-8-2-1-3-9-17)25-20-13-7-6-12-19(20)23-26-28-29(27-23)16-22(31)24-18-10-4-5-11-18/h1-3,6-9,12-13,18H,4-5,10-11,14-16H2,(H,24,31)(H,25,30) |
| InChIKey | BOKBMRQEDBNBLG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |