C15H19N5O — CID 6458492
N-cyclopentyl-2-[5-(3-methylphenyl)tetrazol-2-yl]acetamide (PubChem CID 6458492) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-cyclopentyl-2-[5-(3-methylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[5-(3-methylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6458492 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-cyclopentyl-2-[5-(3-methylphenyl)tetrazol-2-yl]acetamide |
| SMILES | Cc1cccc(-c2nnn(CC(=O)NC3CCCC3)n2)c1 |
| InChI | InChI=1S/C15H19N5O/c1-11-5-4-6-12(9-11)15-17-19-20(18-15)10-14(21)16-13-7-2-3-8-13/h4-6,9,13H,2-3,7-8,10H2,1H3,(H,16,21) |
| InChIKey | YAYAGSHIKSGDDS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |