C18H23N5O2 — CID 18524845
N-cyclohexyl-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]acetamide (PubChem CID 18524845) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-cyclohexyl-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 18524845 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-cyclohexyl-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]acetamide |
| SMILES | C=CCOc1ccc(-c2nnn(CC(=O)NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C18H23N5O2/c1-2-12-25-16-10-8-14(9-11-16)18-20-22-23(21-18)13-17(24)19-15-6-4-3-5-7-15/h2,8-11,15H,1,3-7,12-13H2,(H,19,24) |
| InChIKey | ICIHPSAUFQOLKM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|