C18H23N5O3 — CID 16765364
1-(2,6-dimethylmorpholin-4-yl)-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]ethanone (PubChem CID 16765364) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 16765364 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-2-[5-(4-prop-2-enoxyphenyl)tetrazol-2-yl]ethanone |
| SMILES | C=CCOc1ccc(-c2nnn(CC(=O)N3CC(C)OC(C)C3)n2)cc1 |
| InChI | InChI=1S/C18H23N5O3/c1-4-9-25-16-7-5-15(6-8-16)18-19-21-23(20-18)12-17(24)22-10-13(2)26-14(3)11-22/h4-8,13-14H,1,9-12H2,2-3H3 |
| InChIKey | NLYTXHYZMVUDLT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|