C21H20N6O3 — CID 9468250
(E)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]-3-(4-prop-2-enoxyphenyl)prop-2-enehydrazide (PubChem CID 9468250) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is (E)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]-3-(4-prop-2-enoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]-3-(4-prop-2-enoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9468250 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (E)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]-3-(4-prop-2-enoxyphenyl)prop-2-enehydrazide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)NNC(=O)Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H20N6O3/c1-2-14-30-18-11-8-16(9-12-18)10-13-19(28)22-23-20(29)15-27-25-21(24-26-27)17-6-4-3-5-7-17/h2-13H,1,14-15H2,(H,22,28)(H,23,29)/b13-10+ |
| InChIKey | MQDFBRUABUMNMN-JLHYYAGUSA-N |
| XLogP | 1.77 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|