About (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate
(4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 7486348) has the molecular formula C25H22O3
and a molecular weight of 370.45 g/mol. Its IUPAC name is (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| PubChem CID | 7486348 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)OCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H22O3/c1-2-18-27-24-15-10-20(11-16-24)12-17-25(26)28-19-21-8-13-23(14-9-21)22-6-4-3-5-7-22/h2-17H,1,18-19H2/b17-12+ |
| InChIKey | KKSTWDMUWKLUHG-SFQUDFHCSA-N |
| XLogP | 5.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate?
The IUPAC name of (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate (CID 7486348) is (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate.
What is the SMILES notation for (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate?
The canonical SMILES for (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate is C=CCOc1ccc(/C=C/C(=O)OCc2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate?
The InChIKey is KKSTWDMUWKLUHG-SFQUDFHCSA-N. The full InChI is InChI=1S/C25H22O3/c1-2-18-27-24-15-10-20(11-16-24)12-17-25(26)28-19-21-8-13-23(14-9-21)22-6-4-3-5-7-22/h2-17H,1,18-19H2/b17-12+.
What are the key properties of (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate?
(4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate has a molecular weight of 370.45 g/mol, XLogP of 5.68, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate is sourced from PubChem (CID 7486348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).