C22H26O5 — CID 141278976
benzyl 3-[4-(2,2-diethoxyethoxy)phenyl]prop-2-enoate (PubChem CID 141278976) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is benzyl 3-[4-(2,2-diethoxyethoxy)phenyl]prop-2-enoate.
| Compound Name | benzyl 3-[4-(2,2-diethoxyethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 141278976 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | benzyl 3-[4-(2,2-diethoxyethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(COc1ccc(C=CC(=O)OCc2ccccc2)cc1)OCC |
| InChI | InChI=1S/C22H26O5/c1-3-24-22(25-4-2)17-26-20-13-10-18(11-14-20)12-15-21(23)27-16-19-8-6-5-7-9-19/h5-15,22H,3-4,16-17H2,1-2H3 |
| InChIKey | YBWXSNHPHCNJOK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|