C22H32N6O — CID 7411277
N-cyclohexyl-2-[5-[4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]tetrazol-2-yl]acetamide (PubChem CID 7411277) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[5-[4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[5-[4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7411277 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | N-cyclohexyl-2-[5-[4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]tetrazol-2-yl]acetamide |
| SMILES | C[C@H]1CCCCN1Cc1ccc(-c2nnn(CC(=O)NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H32N6O/c1-17-7-5-6-14-27(17)15-18-10-12-19(13-11-18)22-24-26-28(25-22)16-21(29)23-20-8-3-2-4-9-20/h10-13,17,20H,2-9,14-16H2,1H3,(H,23,29)/t17-/m0/s1 |
| InChIKey | ALXVQBNGZRZDEE-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |