C20H21N5O3 — CID 1463735
N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]butanamide (PubChem CID 1463735) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]butanamide.
| Compound Name | N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 1463735 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccccc1-c1nnn(CC(=O)c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C20H21N5O3/c1-3-6-19(27)21-17-8-5-4-7-16(17)20-22-24-25(23-20)13-18(26)14-9-11-15(28-2)12-10-14/h4-5,7-12H,3,6,13H2,1-2H3,(H,21,27) |
| InChIKey | XDTYOKIXOAOWGN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |