C23H29N3O5S — CID 31351989
tert-butyl 4-[4-[(2-methylphenyl)sulfamoyl]benzoyl]piperazine-1-carboxylate (PubChem CID 31351989) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2-methylphenyl)sulfamoyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2-methylphenyl)sulfamoyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 31351989 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | tert-butyl 4-[4-[(2-methylphenyl)sulfamoyl]benzoyl]piperazine-1-carboxylate |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O5S/c1-17-7-5-6-8-20(17)24-32(29,30)19-11-9-18(10-12-19)21(27)25-13-15-26(16-14-25)22(28)31-23(2,3)4/h5-12,24H,13-16H2,1-4H3 |
| InChIKey | FPQBGMBZZROBBF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |