C23H28N2O3S — CID 9164303
4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 9164303) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9164303 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C(=O)N2CC[C@H]3CCCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-17-6-2-5-9-22(17)24-29(27,28)21-12-10-19(11-13-21)23(26)25-15-14-18-7-3-4-8-20(18)16-25/h2,5-6,9-13,18,20,24H,3-4,7-8,14-16H2,1H3/t18-,20-/m1/s1 |
| InChIKey | ATNUPGGIWHCQIX-UYAOXDASSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |