C17H18F3NO3 — CID 134348949
tert-butyl 3-[2-formyl-5-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 134348949) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is tert-butyl 3-[2-formyl-5-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-formyl-5-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 134348949 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | tert-butyl 3-[2-formyl-5-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cc(C(F)(F)F)ccc2C=O)C1 |
| InChI | InChI=1S/C17H18F3NO3/c1-16(2,3)24-15(23)21-7-6-11(9-21)14-8-13(17(18,19)20)5-4-12(14)10-22/h4-6,8,10H,7,9H2,1-3H3 |
| InChIKey | QOQKAOMWSILUPE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|