C20H20FN5O5 — CID 118293107
tert-butyl 3-[6-[(2-amino-2-oxoethyl)amino]-5-nitro-3-pyridinyl]-6-fluoroindole-1-carboxylate (PubChem CID 118293107) has the molecular formula C20H20FN5O5 and a molecular weight of 429.41 g/mol. Its IUPAC name is tert-butyl 3-[6-[(2-amino-2-oxoethyl)amino]-5-nitro-3-pyridinyl]-6-fluoroindole-1-carboxylate.
| Compound Name | tert-butyl 3-[6-[(2-amino-2-oxoethyl)amino]-5-nitro-3-pyridinyl]-6-fluoroindole-1-carboxylate |
|---|---|
| PubChem CID | 118293107 |
| Molecular Formula | C20H20FN5O5 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | tert-butyl 3-[6-[(2-amino-2-oxoethyl)amino]-5-nitro-3-pyridinyl]-6-fluoroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cnc(NCC(N)=O)c([N+](=O)[O-])c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C20H20FN5O5/c1-20(2,3)31-19(28)25-10-14(13-5-4-12(21)7-15(13)25)11-6-16(26(29)30)18(23-8-11)24-9-17(22)27/h4-8,10H,9H2,1-3H3,(H2,22,27)(H,23,24) |
| InChIKey | DYWDORNFSWGIBZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|