C24H21FN4O5 — CID 118382496
tert-butyl 3-[2-[(2,5-dioxoimidazolidin-4-yl)methyl]-1,3-benzoxazol-6-yl]-6-fluoroindole-1-carboxylate (PubChem CID 118382496) has the molecular formula C24H21FN4O5 and a molecular weight of 464.45 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2,5-dioxoimidazolidin-4-yl)methyl]-1,3-benzoxazol-6-yl]-6-fluoroindole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(2,5-dioxoimidazolidin-4-yl)methyl]-1,3-benzoxazol-6-yl]-6-fluoroindole-1-carboxylate |
|---|---|
| PubChem CID | 118382496 |
| Molecular Formula | C24H21FN4O5 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | tert-butyl 3-[2-[(2,5-dioxoimidazolidin-4-yl)methyl]-1,3-benzoxazol-6-yl]-6-fluoroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2ccc3nc(CC4NC(=O)NC4=O)oc3c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C24H21FN4O5/c1-24(2,3)34-23(32)29-11-15(14-6-5-13(25)9-18(14)29)12-4-7-16-19(8-12)33-20(26-16)10-17-21(30)28-22(31)27-17/h4-9,11,17H,10H2,1-3H3,(H2,27,28,30,31) |
| InChIKey | UIXQCNNKFSQTNQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|