C14H15NO5S — CID 57481619
tert-butyl 4-(2-methoxy-2-oxoacetyl)thieno[2,3-b]pyrrole-6-carboxylate (PubChem CID 57481619) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is tert-butyl 4-(2-methoxy-2-oxoacetyl)thieno[2,3-b]pyrrole-6-carboxylate.
| Compound Name | tert-butyl 4-(2-methoxy-2-oxoacetyl)thieno[2,3-b]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 57481619 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | tert-butyl 4-(2-methoxy-2-oxoacetyl)thieno[2,3-b]pyrrole-6-carboxylate |
| SMILES | COC(=O)C(=O)c1cn(C(=O)OC(C)(C)C)c2sccc12 |
| InChI | InChI=1S/C14H15NO5S/c1-14(2,3)20-13(18)15-7-9(10(16)12(17)19-4)8-5-6-21-11(8)15/h5-7H,1-4H3 |
| InChIKey | JEZLNLLQPCTMTP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|