C8H9ClN2O4 — CID 71279168
dimethyl 2-chloro-1-methylimidazole-4,5-dicarboxylate (PubChem CID 71279168) has the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. Its IUPAC name is dimethyl 2-chloro-1-methylimidazole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-chloro-1-methylimidazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 71279168 |
| Molecular Formula | C8H9ClN2O4 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | dimethyl 2-chloro-1-methylimidazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nc(Cl)n(C)c1C(=O)OC |
| InChI | InChI=1S/C8H9ClN2O4/c1-11-5(7(13)15-3)4(6(12)14-2)10-8(11)9/h1-3H3 |
| InChIKey | BUDJSHGMTXZIOS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |