C18H16ClN3O5S — CID 166330541
methyl 3-[[4-(4-chlorophenoxy)phenyl]sulfonylamino]-1-methylpyrazole-5-carboxylate (PubChem CID 166330541) has the molecular formula C18H16ClN3O5S and a molecular weight of 421.86 g/mol. Its IUPAC name is methyl 3-[[4-(4-chlorophenoxy)phenyl]sulfonylamino]-1-methylpyrazole-5-carboxylate.
| Compound Name | methyl 3-[[4-(4-chlorophenoxy)phenyl]sulfonylamino]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 166330541 |
| Molecular Formula | C18H16ClN3O5S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | methyl 3-[[4-(4-chlorophenoxy)phenyl]sulfonylamino]-1-methylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)nn1C |
| InChI | InChI=1S/C18H16ClN3O5S/c1-22-16(18(23)26-2)11-17(20-22)21-28(24,25)15-9-7-14(8-10-15)27-13-5-3-12(19)4-6-13/h3-11H,1-2H3,(H,20,21) |
| InChIKey | QPTCQXGOBLLZLJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |