C14H16ClN3O4S — CID 42555751
methyl 4-[(4-chlorophenyl)sulfonylamino]-1-ethyl-3-methylpyrazole-5-carboxylate (PubChem CID 42555751) has the molecular formula C14H16ClN3O4S and a molecular weight of 357.82 g/mol. Its IUPAC name is methyl 4-[(4-chlorophenyl)sulfonylamino]-1-ethyl-3-methylpyrazole-5-carboxylate.
| Compound Name | methyl 4-[(4-chlorophenyl)sulfonylamino]-1-ethyl-3-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 42555751 |
| Molecular Formula | C14H16ClN3O4S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | methyl 4-[(4-chlorophenyl)sulfonylamino]-1-ethyl-3-methylpyrazole-5-carboxylate |
| SMILES | CCn1nc(C)c(NS(=O)(=O)c2ccc(Cl)cc2)c1C(=O)OC |
| InChI | InChI=1S/C14H16ClN3O4S/c1-4-18-13(14(19)22-3)12(9(2)16-18)17-23(20,21)11-7-5-10(15)6-8-11/h5-8,17H,4H2,1-3H3 |
| InChIKey | GDOWTWFTOMAPEO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |