C13H12ClN3O4S — CID 56806878
N-(4-chlorophenyl)sulfonyl-1-ethyl-6-oxopyridazine-3-carboxamide (PubChem CID 56806878) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-1-ethyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-1-ethyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 56806878 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-1-ethyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCn1nc(C(=O)NS(=O)(=O)c2ccc(Cl)cc2)ccc1=O |
| InChI | InChI=1S/C13H12ClN3O4S/c1-2-17-12(18)8-7-11(15-17)13(19)16-22(20,21)10-5-3-9(14)4-6-10/h3-8H,2H2,1H3,(H,16,19) |
| InChIKey | JGANNFVKLGZBMR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |