C16H21ClN2O3 — CID 57081064
methyl 1-(2-amino-2-methylpropyl)-5-chloro-3-ethoxyindole-2-carboxylate (PubChem CID 57081064) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is methyl 1-(2-amino-2-methylpropyl)-5-chloro-3-ethoxyindole-2-carboxylate.
| Compound Name | methyl 1-(2-amino-2-methylpropyl)-5-chloro-3-ethoxyindole-2-carboxylate |
|---|---|
| PubChem CID | 57081064 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | methyl 1-(2-amino-2-methylpropyl)-5-chloro-3-ethoxyindole-2-carboxylate |
| SMILES | CCOc1c(C(=O)OC)n(CC(C)(C)N)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H21ClN2O3/c1-5-22-14-11-8-10(17)6-7-12(11)19(9-16(2,3)18)13(14)15(20)21-4/h6-8H,5,9,18H2,1-4H3 |
| InChIKey | JOHCFHPMBYASMU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |