C13H17FN2O3 — CID 88919955
1-[(3-fluorophenyl)methyl]aziridin-2-one;3-methoxypropanamide (PubChem CID 88919955) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]aziridin-2-one;3-methoxypropanamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]aziridin-2-one;3-methoxypropanamide |
|---|---|
| PubChem CID | 88919955 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]aziridin-2-one;3-methoxypropanamide |
| SMILES | COCCC(N)=O.O=C1CN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H8FNO.C4H9NO2/c10-8-3-1-2-7(4-8)5-11-6-9(11)12;1-7-3-2-4(5)6/h1-4H,5-6H2;2-3H2,1H3,(H2,5,6) |
| InChIKey | YFNLFGBOZDDDGH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|