C19H19FN2O2 — CID 165423232
(3S)-1-benzyl-4-[(3-fluorophenyl)methyl]-3-methylpiperazine-2,5-dione (PubChem CID 165423232) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is (3S)-1-benzyl-4-[(3-fluorophenyl)methyl]-3-methylpiperazine-2,5-dione.
| Compound Name | (3S)-1-benzyl-4-[(3-fluorophenyl)methyl]-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 165423232 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3S)-1-benzyl-4-[(3-fluorophenyl)methyl]-3-methylpiperazine-2,5-dione |
| SMILES | C[C@H]1C(=O)N(Cc2ccccc2)CC(=O)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H19FN2O2/c1-14-19(24)21(11-15-6-3-2-4-7-15)13-18(23)22(14)12-16-8-5-9-17(20)10-16/h2-10,14H,11-13H2,1H3/t14-/m0/s1 |
| InChIKey | FQALJNMHJJTWCJ-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |