C18H19N3O2 — CID 164687936
(3R)-1-benzyl-3-methyl-4-(pyridin-2-ylmethyl)piperazine-2,5-dione (PubChem CID 164687936) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (3R)-1-benzyl-3-methyl-4-(pyridin-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | (3R)-1-benzyl-3-methyl-4-(pyridin-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 164687936 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3R)-1-benzyl-3-methyl-4-(pyridin-2-ylmethyl)piperazine-2,5-dione |
| SMILES | C[C@@H]1C(=O)N(Cc2ccccc2)CC(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C18H19N3O2/c1-14-18(23)20(11-15-7-3-2-4-8-15)13-17(22)21(14)12-16-9-5-6-10-19-16/h2-10,14H,11-13H2,1H3/t14-/m1/s1 |
| InChIKey | PHJOZZJOZBFAOX-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |