C33H34N4O4 — CID 177116281
(3S)-1,4,7-tribenzyl-3-methyl-10-prop-2-ynyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 177116281) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is (3S)-1,4,7-tribenzyl-3-methyl-10-prop-2-ynyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | (3S)-1,4,7-tribenzyl-3-methyl-10-prop-2-ynyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 177116281 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | (3S)-1,4,7-tribenzyl-3-methyl-10-prop-2-ynyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | C#CCN1CC(=O)N(Cc2ccccc2)CC(=O)N(Cc2ccccc2)[C@@H](C)C(=O)N(Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C33H34N4O4/c1-3-19-34-23-31(39)35(20-27-13-7-4-8-14-27)25-32(40)37(22-29-17-11-6-12-18-29)26(2)33(41)36(24-30(34)38)21-28-15-9-5-10-16-28/h1,4-18,26H,19-25H2,2H3/t26-/m0/s1 |
| InChIKey | AKNIQUPUAOURKP-SANMLTNESA-N |
| XLogP | 2.94 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|