C17H24N2O4 — CID 165418850
(3S)-1-benzyl-4-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione (PubChem CID 165418850) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3S)-1-benzyl-4-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione.
| Compound Name | (3S)-1-benzyl-4-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 165418850 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S)-1-benzyl-4-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione |
| SMILES | COCCOCCN1C(=O)CN(Cc2ccccc2)C(=O)[C@@H]1C |
| InChI | InChI=1S/C17H24N2O4/c1-14-17(21)18(12-15-6-4-3-5-7-15)13-16(20)19(14)8-9-23-11-10-22-2/h3-7,14H,8-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | RMUYFDFAKAIMOF-AWEZNQCLSA-N |
| XLogP | 0.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|