About (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione
(3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione (PubChem CID 165425878) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione |
| PubChem CID | 165425878 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione |
| SMILES | Cc1ccc(OCCN2C(=O)CN(Cc3ccccc3)C(=O)[C@@H]2C)c(C)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-16-9-10-20(17(2)13-16)27-12-11-24-18(3)22(26)23(15-21(24)25)14-19-7-5-4-6-8-19/h4-10,13,18H,11-12,14-15H2,1-3H3/t18-/m0/s1 |
| InChIKey | RNAFXKLEZCANKC-SFHVURJKSA-N |
| XLogP | 2.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione?
The IUPAC name of (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione (CID 165425878) is (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione.
What is the SMILES notation for (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione?
The canonical SMILES for (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione is Cc1ccc(OCCN2C(=O)CN(Cc3ccccc3)C(=O)[C@@H]2C)c(C)c1.
What is the InChIKey of (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione?
The InChIKey is RNAFXKLEZCANKC-SFHVURJKSA-N. The full InChI is InChI=1S/C22H26N2O3/c1-16-9-10-20(17(2)13-16)27-12-11-24-18(3)22(26)23(15-21(24)25)14-19-7-5-4-6-8-19/h4-10,13,18H,11-12,14-15H2,1-3H3/t18-/m0/s1.
What are the key properties of (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione?
(3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione has a molecular weight of 366.46 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-benzyl-4-[2-(2,4-dimethylphenoxy)ethyl]-3-methylpiperazine-2,5-dione is sourced from PubChem (CID 165425878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).