C26H22FN5O — CID 66905317
1-[(3-fluorophenyl)methyl]-6-methyl-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)indole-2-carboxamide (PubChem CID 66905317) has the molecular formula C26H22FN5O and a molecular weight of 439.49 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-6-methyl-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)indole-2-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-6-methyl-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 66905317 |
| Molecular Formula | C26H22FN5O |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-6-methyl-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)Nc3cnc4c(c3)nc3n4CCC3)n(Cc3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C26H22FN5O/c1-16-7-8-18-12-23(32(22(18)10-16)15-17-4-2-5-19(27)11-17)26(33)29-20-13-21-25(28-14-20)31-9-3-6-24(31)30-21/h2,4-5,7-8,10-14H,3,6,9,15H2,1H3,(H,29,33) |
| InChIKey | SCHANKIAXBHYPT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |