C25H20F2N6O — CID 66905436
N-(5-amino-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)-5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxamide (PubChem CID 66905436) has the molecular formula C25H20F2N6O and a molecular weight of 458.47 g/mol. Its IUPAC name is N-(5-amino-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)-5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxamide.
| Compound Name | N-(5-amino-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)-5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 66905436 |
| Molecular Formula | C25H20F2N6O |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-(5-amino-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-10-yl)-5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxamide |
| SMILES | NC1CCn2c1nc1cc(NC(=O)c3cc4cc(F)ccc4n3Cc3cccc(F)c3)cnc12 |
| InChI | InChI=1S/C25H20F2N6O/c26-16-3-1-2-14(8-16)13-33-21-5-4-17(27)9-15(21)10-22(33)25(34)30-18-11-20-24(29-12-18)32-7-6-19(28)23(32)31-20/h1-5,8-12,19H,6-7,13,28H2,(H,30,34) |
| InChIKey | UXYXHNBHZOJCFA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |