C25H20F2N2O2 — CID 42804636
N-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-1-prop-2-enylindole-2-carboxamide (PubChem CID 42804636) has the molecular formula C25H20F2N2O2 and a molecular weight of 418.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-1-prop-2-enylindole-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 42804636 |
| Molecular Formula | C25H20F2N2O2 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2ccc(F)cc2)cc2c(OCc3ccccc3F)cccc21 |
| InChI | InChI=1S/C25H20F2N2O2/c1-2-14-29-22-8-5-9-24(31-16-17-6-3-4-7-21(17)27)20(22)15-23(29)25(30)28-19-12-10-18(26)11-13-19/h2-13,15H,1,14,16H2,(H,28,30) |
| InChIKey | FKUWXANOFRQPLS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|