C28H29N5O4 — CID 70171565
acetic acid;(3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate (PubChem CID 70171565) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is acetic acid;(3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate.
| Compound Name | acetic acid;(3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 70171565 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | acetic acid;(3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate |
| SMILES | CC(=O)O.[H]/N=C(\N)c1cccc(COC(=O)c2cc3c(C)cccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C26H25N5O2.C2H4O2/c1-16-5-2-10-22-21(16)13-23(31(22)14-17-6-3-8-19(11-17)24(27)28)26(32)33-15-18-7-4-9-20(12-18)25(29)30;1-2(3)4/h2-13H,14-15H2,1H3,(H3,27,28)(H3,29,30);1H3,(H,3,4) |
| InChIKey | ZLZBRBUXQKZTDO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 168.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|