C17H20N2O — CID 61218400
3-[(2,4,6-trimethylphenoxy)methyl]benzenecarboximidamide (PubChem CID 61218400) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[(2,4,6-trimethylphenoxy)methyl]benzenecarboximidamide.
| Compound Name | 3-[(2,4,6-trimethylphenoxy)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 61218400 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-[(2,4,6-trimethylphenoxy)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(COc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C17H20N2O/c1-11-7-12(2)16(13(3)8-11)20-10-14-5-4-6-15(9-14)17(18)19/h4-9H,10H2,1-3H3,(H3,18,19) |
| InChIKey | JCIGQXWUCUWGDJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|