C16H17IN2O — CID 65476998
4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzenecarboximidamide (PubChem CID 65476998) has the molecular formula C16H17IN2O and a molecular weight of 380.23 g/mol. Its IUPAC name is 4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzenecarboximidamide.
| Compound Name | 4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 65476998 |
| Molecular Formula | C16H17IN2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 4-[(4-iodophenyl)methoxy]-3,5-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)c(OCc2ccc(I)cc2)c(C)c1 |
| InChI | InChI=1S/C16H17IN2O/c1-10-7-13(16(18)19)8-11(2)15(10)20-9-12-3-5-14(17)6-4-12/h3-8H,9H2,1-2H3,(H3,18,19) |
| InChIKey | RQOKBTOPDDTJBL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|