C17H19FN2O — CID 114346108
4-[(4-fluoro-2-methylphenyl)methoxy]-3,5-dimethylbenzenecarboximidamide (PubChem CID 114346108) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methylphenyl)methoxy]-3,5-dimethylbenzenecarboximidamide.
| Compound Name | 4-[(4-fluoro-2-methylphenyl)methoxy]-3,5-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114346108 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-[(4-fluoro-2-methylphenyl)methoxy]-3,5-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)c(OCc2ccc(F)cc2C)c(C)c1 |
| InChI | InChI=1S/C17H19FN2O/c1-10-8-15(18)5-4-13(10)9-21-16-11(2)6-14(17(19)20)7-12(16)3/h4-8H,9H2,1-3H3,(H3,19,20) |
| InChIKey | NQUUEAQXOZKDFI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|