C12H18N2O3S — CID 65471366
3,5-dimethyl-4-(2-methylsulfonylethoxy)benzenecarboximidamide (PubChem CID 65471366) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-methylsulfonylethoxy)benzenecarboximidamide.
| Compound Name | 3,5-dimethyl-4-(2-methylsulfonylethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 65471366 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3,5-dimethyl-4-(2-methylsulfonylethoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)c(OCCS(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-8-6-10(12(13)14)7-9(2)11(8)17-4-5-18(3,15)16/h6-7H,4-5H2,1-3H3,(H3,13,14) |
| InChIKey | JENWZUKDMQTMFG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|