C13H20N2O — CID 65470800
4-butan-2-yloxy-3,5-dimethylbenzenecarboximidamide (PubChem CID 65470800) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-butan-2-yloxy-3,5-dimethylbenzenecarboximidamide.
| Compound Name | 4-butan-2-yloxy-3,5-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 65470800 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-butan-2-yloxy-3,5-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)c(OC(C)CC)c(C)c1 |
| InChI | InChI=1S/C13H20N2O/c1-5-10(4)16-12-8(2)6-11(13(14)15)7-9(12)3/h6-7,10H,5H2,1-4H3,(H3,14,15) |
| InChIKey | OVEGQTXJCXZXBX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|