C15H15IO — CID 65489726
2-[(4-iodophenyl)methoxy]-1,3-dimethylbenzene (PubChem CID 65489726) has the molecular formula C15H15IO and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-[(4-iodophenyl)methoxy]-1,3-dimethylbenzene.
| Compound Name | 2-[(4-iodophenyl)methoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 65489726 |
| Molecular Formula | C15H15IO |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-[(4-iodophenyl)methoxy]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C15H15IO/c1-11-4-3-5-12(2)15(11)17-10-13-6-8-14(16)9-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | WAXYTGZGCKBSGT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|