C15H14Cl2N4O — CID 73355195
4-[(3-carbamimidoylphenyl)methoxy]-3,5-dichlorobenzenecarboximidamide (PubChem CID 73355195) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is 4-[(3-carbamimidoylphenyl)methoxy]-3,5-dichlorobenzenecarboximidamide.
| Compound Name | 4-[(3-carbamimidoylphenyl)methoxy]-3,5-dichlorobenzenecarboximidamide |
|---|---|
| PubChem CID | 73355195 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-[(3-carbamimidoylphenyl)methoxy]-3,5-dichlorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(COc2c(Cl)cc(/C(N)=N/[H])cc2Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N4O/c16-11-5-10(15(20)21)6-12(17)13(11)22-7-8-2-1-3-9(4-8)14(18)19/h1-6H,7H2,(H3,18,19)(H3,20,21) |
| InChIKey | JKKIERMWSKMLGH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|