C27H25N3O2 — CID 143028132
3-[[5-[(3-ethanimidoylphenyl)methoxy]naphthalen-1-yl]oxymethyl]benzenecarboximidamide (PubChem CID 143028132) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-[[5-[(3-ethanimidoylphenyl)methoxy]naphthalen-1-yl]oxymethyl]benzenecarboximidamide.
| Compound Name | 3-[[5-[(3-ethanimidoylphenyl)methoxy]naphthalen-1-yl]oxymethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 143028132 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-[[5-[(3-ethanimidoylphenyl)methoxy]naphthalen-1-yl]oxymethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(COc2cccc3c(OCc4cccc(/C(C)=N/[H])c4)cccc23)c1 |
| InChI | InChI=1S/C27H25N3O2/c1-18(28)21-8-2-6-19(14-21)16-31-25-12-4-11-24-23(25)10-5-13-26(24)32-17-20-7-3-9-22(15-20)27(29)30/h2-15,28H,16-17H2,1H3,(H3,29,30)/b28-18+ |
| InChIKey | LNJLMJXNKUTRLB-MTDXEUNCSA-N |
| XLogP | 5.67 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|