C34H31N5O5 — CID 70086957
(3-carbamimidoylphenyl)methyl 3-acetyloxy-1-[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxylate (PubChem CID 70086957) has the molecular formula C34H31N5O5 and a molecular weight of 589.65 g/mol. Its IUPAC name is (3-carbamimidoylphenyl)methyl 3-acetyloxy-1-[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxylate.
| Compound Name | (3-carbamimidoylphenyl)methyl 3-acetyloxy-1-[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxylate |
|---|---|
| PubChem CID | 70086957 |
| Molecular Formula | C34H31N5O5 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | (3-carbamimidoylphenyl)methyl 3-acetyloxy-1-[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(COC(=O)c2c(OC(C)=O)c3cc(OCc4ccccc4)ccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C34H31N5O5/c1-21(40)44-31-28-17-27(42-19-22-7-3-2-4-8-22)13-14-29(28)39(18-23-9-5-11-25(15-23)32(35)36)30(31)34(41)43-20-24-10-6-12-26(16-24)33(37)38/h2-17H,18-20H2,1H3,(H3,35,36)(H3,37,38) |
| InChIKey | QKDPPACYOHSDCN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|