C26H25BrN4O — CID 10983794
3-bromo-1-[(3-carbamimidoylphenyl)methyl]-N-[(3,5-dimethylphenyl)methyl]indole-2-carboxamide (PubChem CID 10983794) has the molecular formula C26H25BrN4O and a molecular weight of 489.42 g/mol. Its IUPAC name is 3-bromo-1-[(3-carbamimidoylphenyl)methyl]-N-[(3,5-dimethylphenyl)methyl]indole-2-carboxamide.
| Compound Name | 3-bromo-1-[(3-carbamimidoylphenyl)methyl]-N-[(3,5-dimethylphenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 10983794 |
| Molecular Formula | C26H25BrN4O |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-bromo-1-[(3-carbamimidoylphenyl)methyl]-N-[(3,5-dimethylphenyl)methyl]indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3cc(C)cc(C)c3)c(Br)c3ccccc32)c1 |
| InChI | InChI=1S/C26H25BrN4O/c1-16-10-17(2)12-19(11-16)14-30-26(32)24-23(27)21-8-3-4-9-22(21)31(24)15-18-6-5-7-20(13-18)25(28)29/h3-13H,14-15H2,1-2H3,(H3,28,29)(H,30,32) |
| InChIKey | XRHPKJZWBNJDLW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|