C29H26N6O — CID 146459893
3-carbamimidoyl-N-[(4-carbamimidoylphenyl)methyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxamide (PubChem CID 146459893) has the molecular formula C29H26N6O and a molecular weight of 474.57 g/mol. Its IUPAC name is 3-carbamimidoyl-N-[(4-carbamimidoylphenyl)methyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxamide.
| Compound Name | 3-carbamimidoyl-N-[(4-carbamimidoylphenyl)methyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 146459893 |
| Molecular Formula | C29H26N6O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 3-carbamimidoyl-N-[(4-carbamimidoylphenyl)methyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2c(/C(N)=N/[H])c3ccccc3n2Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H26N6O/c30-27(31)20-14-12-18(13-15-20)16-34-29(36)26-25(28(32)33)23-10-3-4-11-24(23)35(26)17-21-8-5-7-19-6-1-2-9-22(19)21/h1-15H,16-17H2,(H3,30,31)(H3,32,33)(H,34,36) |
| InChIKey | PSXKDVVCEBSLAS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|