C33H26N6O2 — CID 147392136
6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-[4-(pyridine-2-carbonylamino)phenyl]indole-2-carboxamide (PubChem CID 147392136) has the molecular formula C33H26N6O2 and a molecular weight of 538.61 g/mol. Its IUPAC name is 6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-[4-(pyridine-2-carbonylamino)phenyl]indole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-[4-(pyridine-2-carbonylamino)phenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 147392136 |
| Molecular Formula | C33H26N6O2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-[4-(pyridine-2-carbonylamino)phenyl]indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)Nc3ccc(NC(=O)c4ccccn4)cc3)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C33H26N6O2/c34-31(35)23-12-11-22-18-30(39(29(22)19-23)20-24-8-5-7-21-6-1-2-9-27(21)24)33(41)38-26-15-13-25(14-16-26)37-32(40)28-10-3-4-17-36-28/h1-19H,20H2,(H3,34,35)(H,37,40)(H,38,41) |
| InChIKey | DNBOVDJLGRAWPT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|