C28H23N3O2 — CID 167340909
1-[(3-benzylnaphthalen-1-yl)methyl]-6-carbamimidoylindole-2-carboxylic acid (PubChem CID 167340909) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-[(3-benzylnaphthalen-1-yl)methyl]-6-carbamimidoylindole-2-carboxylic acid.
| Compound Name | 1-[(3-benzylnaphthalen-1-yl)methyl]-6-carbamimidoylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 167340909 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-[(3-benzylnaphthalen-1-yl)methyl]-6-carbamimidoylindole-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)O)n(Cc3cc(Cc4ccccc4)cc4ccccc34)c2c1 |
| InChI | InChI=1S/C28H23N3O2/c29-27(30)22-11-10-21-15-26(28(32)33)31(25(21)16-22)17-23-14-19(12-18-6-2-1-3-7-18)13-20-8-4-5-9-24(20)23/h1-11,13-16H,12,17H2,(H3,29,30)(H,32,33) |
| InChIKey | PKLBLFUYWBBNEE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|