C27H21N3O4 — CID 167341207
6-[(Z)-N'-hydroxycarbamimidoyl]-1-[(3-phenoxynaphthalen-1-yl)methyl]indole-2-carboxylic acid (PubChem CID 167341207) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 6-[(Z)-N'-hydroxycarbamimidoyl]-1-[(3-phenoxynaphthalen-1-yl)methyl]indole-2-carboxylic acid.
| Compound Name | 6-[(Z)-N'-hydroxycarbamimidoyl]-1-[(3-phenoxynaphthalen-1-yl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 167341207 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 6-[(Z)-N'-hydroxycarbamimidoyl]-1-[(3-phenoxynaphthalen-1-yl)methyl]indole-2-carboxylic acid |
| SMILES | N/C(=N\O)c1ccc2cc(C(=O)O)n(Cc3cc(Oc4ccccc4)cc4ccccc34)c2c1 |
| InChI | InChI=1S/C27H21N3O4/c28-26(29-33)19-11-10-18-14-25(27(31)32)30(24(18)15-19)16-20-13-22(34-21-7-2-1-3-8-21)12-17-6-4-5-9-23(17)20/h1-15,33H,16H2,(H2,28,29)(H,31,32) |
| InChIKey | AJWWVUMUFUCREA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|