C27H29N5O2 — CID 151131483
6-(N'-hydroxycarbamimidoyl)-1-(naphthalen-2-ylmethyl)-N-(piperidin-4-ylmethyl)indole-2-carboxamide (PubChem CID 151131483) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 6-(N'-hydroxycarbamimidoyl)-1-(naphthalen-2-ylmethyl)-N-(piperidin-4-ylmethyl)indole-2-carboxamide.
| Compound Name | 6-(N'-hydroxycarbamimidoyl)-1-(naphthalen-2-ylmethyl)-N-(piperidin-4-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 151131483 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 6-(N'-hydroxycarbamimidoyl)-1-(naphthalen-2-ylmethyl)-N-(piperidin-4-ylmethyl)indole-2-carboxamide |
| SMILES | NC(=NO)c1ccc2cc(C(=O)NCC3CCNCC3)n(Cc3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C27H29N5O2/c28-26(31-34)23-8-7-22-14-25(27(33)30-16-18-9-11-29-12-10-18)32(24(22)15-23)17-19-5-6-20-3-1-2-4-21(20)13-19/h1-8,13-15,18,29,34H,9-12,16-17H2,(H2,28,31)(H,30,33) |
| InChIKey | MUHUAOKPBDVGDV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|