C32H37N5O3 — CID 146460523
tert-butyl 4-[[[6-carbamimidoyl-1-(naphthalen-2-ylmethyl)indole-2-carbonyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 146460523) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is tert-butyl 4-[[[6-carbamimidoyl-1-(naphthalen-2-ylmethyl)indole-2-carbonyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[6-carbamimidoyl-1-(naphthalen-2-ylmethyl)indole-2-carbonyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146460523 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | tert-butyl 4-[[[6-carbamimidoyl-1-(naphthalen-2-ylmethyl)indole-2-carbonyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)NCC3CCN(C(=O)OC(C)(C)C)CC3)n(Cc3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C32H37N5O3/c1-32(2,3)40-31(39)36-14-12-21(13-15-36)19-35-30(38)28-17-25-10-11-26(29(33)34)18-27(25)37(28)20-22-8-9-23-6-4-5-7-24(23)16-22/h4-11,16-18,21H,12-15,19-20H2,1-3H3,(H3,33,34)(H,35,38) |
| InChIKey | FHVDLDCECQKHJF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|