C27H33N5O2 — CID 146459930
6-carbamimidoyl-1-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-(4-methylcyclohexyl)indole-2-carboxamide (PubChem CID 146459930) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 6-carbamimidoyl-1-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-(4-methylcyclohexyl)indole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-1-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-(4-methylcyclohexyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 146459930 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 6-carbamimidoyl-1-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-(4-methylcyclohexyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)NC3CCC(C)CC3)n(Cc3ccc(C(=O)N(C)C)cc3)c2c1 |
| InChI | InChI=1S/C27H33N5O2/c1-17-4-12-22(13-5-17)30-26(33)24-14-20-10-11-21(25(28)29)15-23(20)32(24)16-18-6-8-19(9-7-18)27(34)31(2)3/h6-11,14-15,17,22H,4-5,12-13,16H2,1-3H3,(H3,28,29)(H,30,33) |
| InChIKey | KGCBSOBIPSPRFY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|