C30H27N7O3 — CID 147746992
6-carbamimidoyl-N-(2-oxopiperidin-4-yl)-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide (PubChem CID 147746992) has the molecular formula C30H27N7O3 and a molecular weight of 533.59 g/mol. Its IUPAC name is 6-carbamimidoyl-N-(2-oxopiperidin-4-yl)-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-N-(2-oxopiperidin-4-yl)-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 147746992 |
| Molecular Formula | C30H27N7O3 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 6-carbamimidoyl-N-(2-oxopiperidin-4-yl)-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)NC3CCNC(=O)C3)n(Cc3cc(Oc4ncccn4)cc4ccccc34)c2c1 |
| InChI | InChI=1S/C30H27N7O3/c31-28(32)20-7-6-19-14-26(29(39)36-22-8-11-33-27(38)16-22)37(25(19)15-20)17-21-13-23(40-30-34-9-3-10-35-30)12-18-4-1-2-5-24(18)21/h1-7,9-10,12-15,22H,8,11,16-17H2,(H3,31,32)(H,33,38)(H,36,39) |
| InChIKey | HBLWOTYZTWHYJB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|