C28H31N5O — CID 147984686
6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-(2-piperidin-1-ylethyl)indole-2-carboxamide (PubChem CID 147984686) has the molecular formula C28H31N5O and a molecular weight of 453.59 g/mol. Its IUPAC name is 6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-(2-piperidin-1-ylethyl)indole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-(2-piperidin-1-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 147984686 |
| Molecular Formula | C28H31N5O |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 6-carbamimidoyl-1-(naphthalen-1-ylmethyl)-N-(2-piperidin-1-ylethyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)NCCN3CCCCC3)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C28H31N5O/c29-27(30)22-12-11-21-17-26(28(34)31-13-16-32-14-4-1-5-15-32)33(25(21)18-22)19-23-9-6-8-20-7-2-3-10-24(20)23/h2-3,6-12,17-18H,1,4-5,13-16,19H2,(H3,29,30)(H,31,34) |
| InChIKey | ITXGVVHXZDKABY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|